Home > Data consultation > Aqueous species
 
Aqueous speciesFormula
 Cr(OH)4(HPO4)(H2PO4)-4Cr(OH)4(HPO4)(H2PO4)-4 
Thermodynamics
Individual properties
Molar weight: 312.962 g/mol  ΔGºf-3,287,950 J/mol ref.  Sº: -115.00 J/mol/K ref. 
  ΔHºf-3,935,070 J/mol ref.   
Reaction properties
Chemical reaction:  Cr+3 + 2H2PO4- + 4H2O = Cr(OH)4(HPO4)(H2PO4)-4 + 5H+ 
log10(Keq) = A + B.T + C.T-1 + D.log10(T) + E.T−2 (with T expressed in Kelvin)
A B C D E
 2.30714016e+3   3.45105476e-1   -1.27204341e+5   -8.41971194e+2   6.85387885e+6 
Van t'Hoff
@ 25°C, 1 bar: log 10(Keq)-22.91
ΔH°r53,950 J/mol ref.
T (ºC) : 0 25 60 100 150 200 250 300
log 10(Keq):  -23.81   -22.91   -21.98   -21.24   -20.60   -20.08   -19.48   -18.52 

Home | Legal information | Private area | Contact us | RSS 2.0 BRGM − 3, avenue Claude Guillemin − 45060 Orléans Cedex 2