Home > Data consultation > Mineral species
 
Mineral speciesFormula
 Cu3(PO4)2:3H2OCu3(PO4)2:3H2O 
Mineralogy
Geological context
Thermodynamics
Individual properties
Molar weight: 434.627 g/mol  ΔGºf-2,848,513 J/mol ref.  Sº: 725.36 J/mol/K ref. 
  ΔHºf-3,139,700 J/mol ref.   
Reaction properties
Chemical reaction:  Cu3(PO4)2:3H2O + 4H+ = 3Cu+2 + 2H2PO4- + 3H2O 
log10(Keq) = A + B.T + C.T-1 + D.log10(T) + E.T−2 (with T expressed in Kelvin)
A B C D E
 -2.37368633e+3   -3.51893671e-1   1.31232672e+5   8.50596703e+2   -6.82053839e+6 
Van t'Hoff
@ 25°C, 1 bar: log 10(Keq)-10.43
ΔH°r-125,825 J/mol ref.
T (ºC) : 0 25 60 100 150 200 250 300
log 10(Keq):  -8.38   -10.43   -12.69   -14.63   -16.46   -17.95   -19.36   -21.00 

Home | Legal information | Private area | Contact us | RSS 2.0 BRGM − 3, avenue Claude Guillemin − 45060 Orléans Cedex 2