Home > Data consultation > Mineral species
 
Mineral speciesFormula
 Ca4H(PO4)3:2.5H2OCa4H(PO4)3:2.5H2O 
Mineralogy
Geological context
Thermodynamics
Individual properties
Molar weight: 491.272 g/mol  ΔGºf-6,148,121 J/mol ref.   
   
Reaction properties
Chemical reaction:  Ca4H(PO4)3:2.5H2O + 5H+ = 4Ca+2 + 3H2PO4- + 2.5H2O 
log10(Keq) = A + B.T + C.T-1 + D.log10(T) + E.T−2 (with T expressed in Kelvin)
A B C D E
 1.18125402e+1   0.00000000e+0   0.00000000e+0   0.00000000e+0   0.00000000e+0 
Van t'Hoff
@ 25°C, 1 bar: log 10(Keq)11.81
T (ºC) : 0 25 60 100 150 200 250 300
log 10(Keq):  11.81   11.81   11.81   11.81   11.81   11.81   11.81   11.81 

Home | Legal information | Private area | Contact us | RSS 2.0 BRGM − 3, avenue Claude Guillemin − 45060 Orléans Cedex 2