Home > Data consultation > Aqueous species
 
Aqueous speciesFormula
 Cr(OH)3(H2PO4)-Cr(OH)3(H2PO4)- 
Thermodynamics
Individual properties
Molar weight: 199.975 g/mol  ΔGºf-2,019,372 J/mol ref.  Sº: 63.20 J/mol/K ref. 
  ΔHºf-2,350,790 J/mol ref.   
Reaction properties
Chemical reaction:  Cr+3 + H2PO4- + 3H2O = Cr(OH)3(H2PO4)- + 3H+ 
log10(Keq) = A + B.T + C.T-1 + D.log10(T) + E.T−2 (with T expressed in Kelvin)
A B C D E
 1.32158907e+3   1.97510919e-1   -7.25210443e+4   -4.78634613e+2   3.79740920e+6 
Van t'Hoff
@ 25°C, 1 bar: log 10(Keq)-4.39
ΔH°r49,800 J/mol ref.
T (ºC) : 0 25 60 100 150 200 250 300
log 10(Keq):  -5.21   -4.39   -3.51   -2.79   -2.14   -1.62   -1.08   -0.38 

Home | Legal information | Private area | Contact us | RSS 2.0 BRGM − 3, avenue Claude Guillemin − 45060 Orléans Cedex 2