Home > Data consultation > Aqueous species
 
Aqueous speciesFormula
 Cr(OH)3(HPO4)-2Cr(OH)3(HPO4)-2 
Thermodynamics
Individual properties
Molar weight: 198.967 g/mol  ΔGºf-1,968,666 J/mol ref.  Sº: -74.00 J/mol/K ref. 
  ΔHºf-2,340,990 J/mol ref.   
Reaction properties
Chemical reaction:  Cr+3 + H2PO4- + 3H2O = Cr(OH)3(HPO4)-2 + 4H+ 
log10(Keq) = A + B.T + C.T-1 + D.log10(T) + E.T−2 (with T expressed in Kelvin)
A B C D E
 1.42942995e+3   2.14335216e-1   -7.93896826e+4   -5.20194249e+2   4.16487386e+6 
Van t'Hoff
@ 25°C, 1 bar: log 10(Keq)-13.27
ΔH°r59,600 J/mol ref.
T (ºC) : 0 25 60 100 150 200 250 300
log 10(Keq):  -14.25   -13.27   -12.22   -11.33   -10.52   -9.86   -9.22   -8.40 

Home | Legal information | Private area | Contact us | RSS 2.0 BRGM − 3, avenue Claude Guillemin − 45060 Orléans Cedex 2